C14H19NO4S — CID 128652669
(3,5-dimethylfuran-2-yl)-(1,1-dioxo-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]thiazin-4-yl)methanone (PubChem CID 128652669) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is (3,5-dimethylfuran-2-yl)-(1,1-dioxo-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]thiazin-4-yl)methanone.
| Compound Name | (3,5-dimethylfuran-2-yl)-(1,1-dioxo-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]thiazin-4-yl)methanone |
|---|---|
| PubChem CID | 128652669 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (3,5-dimethylfuran-2-yl)-(1,1-dioxo-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]thiazin-4-yl)methanone |
| SMILES | Cc1cc(C)c(C(=O)N2CCS(=O)(=O)C3CCCC32)o1 |
| InChI | InChI=1S/C14H19NO4S/c1-9-8-10(2)19-13(9)14(16)15-6-7-20(17,18)12-5-3-4-11(12)15/h8,11-12H,3-7H2,1-2H3 |
| InChIKey | RZRGPAMGBVCNAP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |