C13H22N2O3S — CID 119324532
(1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl)-pyrrolidin-2-ylmethanone (PubChem CID 119324532) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is (1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl)-pyrrolidin-2-ylmethanone.
| Compound Name | (1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl)-pyrrolidin-2-ylmethanone |
|---|---|
| PubChem CID | 119324532 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl)-pyrrolidin-2-ylmethanone |
| SMILES | O=C(C1CCCN1)N1CCS(=O)(=O)C2CCCCC21 |
| InChI | InChI=1S/C13H22N2O3S/c16-13(10-4-3-7-14-10)15-8-9-19(17,18)12-6-2-1-5-11(12)15/h10-12,14H,1-9H2 |
| InChIKey | AFNUNHREEYUGLK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |