C17H21NO3S — CID 136587203
1-[(3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-2-(3-cyclopropylphenyl)ethanone (PubChem CID 136587203) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-2-(3-cyclopropylphenyl)ethanone.
| Compound Name | 1-[(3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-2-(3-cyclopropylphenyl)ethanone |
|---|---|
| PubChem CID | 136587203 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-[(3aR,6aS)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-2-(3-cyclopropylphenyl)ethanone |
| SMILES | O=C(Cc1cccc(C2CC2)c1)N1C[C@@H]2CS(=O)(=O)C[C@@H]2C1 |
| InChI | InChI=1S/C17H21NO3S/c19-17(7-12-2-1-3-14(6-12)13-4-5-13)18-8-15-10-22(20,21)11-16(15)9-18/h1-3,6,13,15-16H,4-5,7-11H2/t15-,16+ |
| InChIKey | SNJIQHOROGZVFB-IYBDPMFKSA-N |
| XLogP | 1.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |