C11H11FN2O — CID 129348790
3-fluoro-N-[(2R)-spiro[2.2]pentan-2-yl]pyridine-4-carboxamide (PubChem CID 129348790) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 3-fluoro-N-[(2R)-spiro[2.2]pentan-2-yl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[(2R)-spiro[2.2]pentan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129348790 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-fluoro-N-[(2R)-spiro[2.2]pentan-2-yl]pyridine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CC12CC2)c1ccncc1F |
| InChI | InChI=1S/C11H11FN2O/c12-8-6-13-4-1-7(8)10(15)14-9-5-11(9)2-3-11/h1,4,6,9H,2-3,5H2,(H,14,15)/t9-/m1/s1 |
| InChIKey | KTHOHXKQMXBELQ-SECBINFHSA-N |
| XLogP | 1.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |