C12H20FNO2 — CID 129348839
1-[(2R)-2-(fluoromethyl)-1,4-oxazepan-4-yl]-2,2-dimethylbut-3-en-1-one (PubChem CID 129348839) has the molecular formula C12H20FNO2 and a molecular weight of 229.29 g/mol. Its IUPAC name is 1-[(2R)-2-(fluoromethyl)-1,4-oxazepan-4-yl]-2,2-dimethylbut-3-en-1-one.
| Compound Name | 1-[(2R)-2-(fluoromethyl)-1,4-oxazepan-4-yl]-2,2-dimethylbut-3-en-1-one |
|---|---|
| PubChem CID | 129348839 |
| Molecular Formula | C12H20FNO2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 1-[(2R)-2-(fluoromethyl)-1,4-oxazepan-4-yl]-2,2-dimethylbut-3-en-1-one |
| SMILES | C=CC(C)(C)C(=O)N1CCCO[C@@H](CF)C1 |
| InChI | InChI=1S/C12H20FNO2/c1-4-12(2,3)11(15)14-6-5-7-16-10(8-13)9-14/h4,10H,1,5-9H2,2-3H3/t10-/m0/s1 |
| InChIKey | GHZKGXMFVCQCHG-JTQLQIEISA-N |
| XLogP | 1.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|