C14H19ClN2O2 — CID 129352735
(3S,4R)-3-[(2R)-1-(5-chloro-2-pyridinyl)pyrrolidin-2-yl]oxan-4-ol (PubChem CID 129352735) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is (3S,4R)-3-[(2R)-1-(5-chloro-2-pyridinyl)pyrrolidin-2-yl]oxan-4-ol.
| Compound Name | (3S,4R)-3-[(2R)-1-(5-chloro-2-pyridinyl)pyrrolidin-2-yl]oxan-4-ol |
|---|---|
| PubChem CID | 129352735 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (3S,4R)-3-[(2R)-1-(5-chloro-2-pyridinyl)pyrrolidin-2-yl]oxan-4-ol |
| SMILES | O[C@@H]1CCOC[C@@H]1[C@H]1CCCN1c1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H19ClN2O2/c15-10-3-4-14(16-8-10)17-6-1-2-12(17)11-9-19-7-5-13(11)18/h3-4,8,11-13,18H,1-2,5-7,9H2/t11-,12-,13-/m1/s1 |
| InChIKey | MZGFGHZBASLQAO-JHJVBQTASA-N |
| XLogP | 2.10 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |