C14H19ClN2 — CID 102727780
(4aR,8aR)-1-(5-chloro-2-pyridinyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 102727780) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is (4aR,8aR)-1-(5-chloro-2-pyridinyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aR,8aR)-1-(5-chloro-2-pyridinyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 102727780 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (4aR,8aR)-1-(5-chloro-2-pyridinyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | Clc1ccc(N2CCC[C@H]3CCCC[C@H]32)nc1 |
| InChI | InChI=1S/C14H19ClN2/c15-12-7-8-14(16-10-12)17-9-3-5-11-4-1-2-6-13(11)17/h7-8,10-11,13H,1-6,9H2/t11-,13-/m1/s1 |
| InChIKey | XIVXQRMIMSSYRV-DGCLKSJQSA-N |
| XLogP | 3.89 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |