C14H15F3N4OS — CID 129353225
5-methyl-N-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]thiophene-2-carboxamide (PubChem CID 129353225) has the molecular formula C14H15F3N4OS and a molecular weight of 344.36 g/mol. Its IUPAC name is 5-methyl-N-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 129353225 |
| Molecular Formula | C14H15F3N4OS |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 5-methyl-N-[[(6S)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCc2nnc3n2C[C@@H](C(F)(F)F)CC3)s1 |
| InChI | InChI=1S/C14H15F3N4OS/c1-8-2-4-10(23-8)13(22)18-6-12-20-19-11-5-3-9(7-21(11)12)14(15,16)17/h2,4,9H,3,5-7H2,1H3,(H,18,22)/t9-/m0/s1 |
| InChIKey | IPRZYTCIHLVKFC-VIFPVBQESA-N |
| XLogP | 2.70 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |