C15H27NO2S — CID 129356642
[(2R)-2-(tert-butylsulfanylmethyl)piperidin-1-yl]-[(3R)-oxolan-3-yl]methanone (PubChem CID 129356642) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is [(2R)-2-(tert-butylsulfanylmethyl)piperidin-1-yl]-[(3R)-oxolan-3-yl]methanone.
| Compound Name | [(2R)-2-(tert-butylsulfanylmethyl)piperidin-1-yl]-[(3R)-oxolan-3-yl]methanone |
|---|---|
| PubChem CID | 129356642 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | [(2R)-2-(tert-butylsulfanylmethyl)piperidin-1-yl]-[(3R)-oxolan-3-yl]methanone |
| SMILES | CC(C)(C)SC[C@H]1CCCCN1C(=O)[C@@H]1CCOC1 |
| InChI | InChI=1S/C15H27NO2S/c1-15(2,3)19-11-13-6-4-5-8-16(13)14(17)12-7-9-18-10-12/h12-13H,4-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | GEPFLYIRZWCACZ-CHWSQXEVSA-N |
| XLogP | 2.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |