C20H19NO3 — CID 129362423
(R)-[6-(1,3-dioxan-2-yl)naphthalen-2-yl]-pyridin-3-ylmethanol (PubChem CID 129362423) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (R)-[6-(1,3-dioxan-2-yl)naphthalen-2-yl]-pyridin-3-ylmethanol.
| Compound Name | (R)-[6-(1,3-dioxan-2-yl)naphthalen-2-yl]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 129362423 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (R)-[6-(1,3-dioxan-2-yl)naphthalen-2-yl]-pyridin-3-ylmethanol |
| SMILES | O[C@@H](c1cccnc1)c1ccc2cc(C3OCCCO3)ccc2c1 |
| InChI | InChI=1S/C20H19NO3/c22-19(18-3-1-8-21-13-18)16-6-4-15-12-17(7-5-14(15)11-16)20-23-9-2-10-24-20/h1,3-8,11-13,19-20,22H,2,9-10H2/t19-/m1/s1 |
| InChIKey | WBUQGJKFJTWEPK-LJQANCHMSA-N |
| XLogP | 3.75 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |