C19H29BrO2 — CID 129363836
(2S)-2-[(2R)-7-bromo-2-methyl-2-phenylheptoxy]oxane (PubChem CID 129363836) has the molecular formula C19H29BrO2 and a molecular weight of 369.34 g/mol. Its IUPAC name is (2S)-2-[(2R)-7-bromo-2-methyl-2-phenylheptoxy]oxane.
| Compound Name | (2S)-2-[(2R)-7-bromo-2-methyl-2-phenylheptoxy]oxane |
|---|---|
| PubChem CID | 129363836 |
| Molecular Formula | C19H29BrO2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (2S)-2-[(2R)-7-bromo-2-methyl-2-phenylheptoxy]oxane |
| SMILES | C[C@](CCCCCBr)(CO[C@H]1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C19H29BrO2/c1-19(13-7-3-8-14-20,17-10-4-2-5-11-17)16-22-18-12-6-9-15-21-18/h2,4-5,10-11,18H,3,6-9,12-16H2,1H3/t18-,19-/m0/s1 |
| InChIKey | LLUXRURXTQCXIC-OALUTQOASA-N |
| XLogP | 5.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|