C11H16ClN3 — CID 129366087
6-chloro-N-[(1S,2R)-2-methylcyclohexyl]pyrimidin-4-amine (PubChem CID 129366087) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 6-chloro-N-[(1S,2R)-2-methylcyclohexyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(1S,2R)-2-methylcyclohexyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 129366087 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 6-chloro-N-[(1S,2R)-2-methylcyclohexyl]pyrimidin-4-amine |
| SMILES | C[C@@H]1CCCC[C@@H]1Nc1cc(Cl)ncn1 |
| InChI | InChI=1S/C11H16ClN3/c1-8-4-2-3-5-9(8)15-11-6-10(12)13-7-14-11/h6-9H,2-5H2,1H3,(H,13,14,15)/t8-,9+/m1/s1 |
| InChIKey | BOVMENDMRDQMNO-BDAKNGLRSA-N |
| XLogP | 3.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |