C15H17NO8S — CID 129368934
N-[(2R,3S,4S,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2-oxo-1,3-benzoxathiol-5-yl)oxy]oxan-3-yl]acetamide (PubChem CID 129368934) has the molecular formula C15H17NO8S and a molecular weight of 371.37 g/mol. Its IUPAC name is N-[(2R,3S,4S,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2-oxo-1,3-benzoxathiol-5-yl)oxy]oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3S,4S,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2-oxo-1,3-benzoxathiol-5-yl)oxy]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 129368934 |
| Molecular Formula | C15H17NO8S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[(2R,3S,4S,5S,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2-oxo-1,3-benzoxathiol-5-yl)oxy]oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](Oc2ccc3oc(=O)sc3c2)O[C@@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H17NO8S/c1-6(18)16-11-13(20)12(19)9(5-17)23-14(11)22-7-2-3-8-10(4-7)25-15(21)24-8/h2-4,9,11-14,17,19-20H,5H2,1H3,(H,16,18)/t9-,11-,12+,13-,14-/m0/s1 |
| InChIKey | ZRBWAQDAEXPMLS-HNGSFYKJSA-N |
| XLogP | -0.82 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|