C15H15Cl2NO8S — CID 129368954
N-[(2R,3S,4S,5S,6S)-2-[(6,7-dichloro-2-oxo-1,3-benzoxathiol-5-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 129368954) has the molecular formula C15H15Cl2NO8S and a molecular weight of 440.26 g/mol. Its IUPAC name is N-[(2R,3S,4S,5S,6S)-2-[(6,7-dichloro-2-oxo-1,3-benzoxathiol-5-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3S,4S,5S,6S)-2-[(6,7-dichloro-2-oxo-1,3-benzoxathiol-5-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 129368954 |
| Molecular Formula | C15H15Cl2NO8S |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | N-[(2R,3S,4S,5S,6S)-2-[(6,7-dichloro-2-oxo-1,3-benzoxathiol-5-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](Oc2cc3sc(=O)oc3c(Cl)c2Cl)O[C@@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H15Cl2NO8S/c1-4(20)18-10-12(22)11(21)6(3-19)25-14(10)24-5-2-7-13(9(17)8(5)16)26-15(23)27-7/h2,6,10-12,14,19,21-22H,3H2,1H3,(H,18,20)/t6-,10-,11+,12-,14-/m0/s1 |
| InChIKey | AXRUKOYBSKRHCP-DAOSYYDHSA-N |
| XLogP | 0.48 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|