C17H21NO8S — CID 129408744
N-[(2R,3R,4S,5R,6R)-2-[(6,7-dimethyl-2-oxo-1,3-benzoxathiol-5-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 129408744) has the molecular formula C17H21NO8S and a molecular weight of 399.42 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R,6R)-2-[(6,7-dimethyl-2-oxo-1,3-benzoxathiol-5-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4S,5R,6R)-2-[(6,7-dimethyl-2-oxo-1,3-benzoxathiol-5-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 129408744 |
| Molecular Formula | C17H21NO8S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N-[(2R,3R,4S,5R,6R)-2-[(6,7-dimethyl-2-oxo-1,3-benzoxathiol-5-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](Oc2cc3sc(=O)oc3c(C)c2C)O[C@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H21NO8S/c1-6-7(2)15-11(27-17(23)26-15)4-9(6)24-16-12(18-8(3)20)14(22)13(21)10(5-19)25-16/h4,10,12-14,16,19,21-22H,5H2,1-3H3,(H,18,20)/t10-,12-,13+,14+,16+/m1/s1 |
| InChIKey | AUEVUAPYHDXNFK-TZHJVIJJSA-N |
| XLogP | -0.21 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|