C11H13F3N2O — CID 129371027
(3S)-1-(pyridin-3-ylmethyl)-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 129371027) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is (3S)-1-(pyridin-3-ylmethyl)-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | (3S)-1-(pyridin-3-ylmethyl)-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129371027 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (3S)-1-(pyridin-3-ylmethyl)-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | O[C@@]1(C(F)(F)F)CCN(Cc2cccnc2)C1 |
| InChI | InChI=1S/C11H13F3N2O/c12-11(13,14)10(17)3-5-16(8-10)7-9-2-1-4-15-6-9/h1-2,4,6,17H,3,5,7-8H2/t10-/m0/s1 |
| InChIKey | YVZNOLRUVOTZKQ-JTQLQIEISA-N |
| XLogP | 1.58 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |