C10H16O4 — CID 12937296
4-(2,5-dimethoxy-2H-furan-5-yl)butan-2-one (PubChem CID 12937296) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 4-(2,5-dimethoxy-2H-furan-5-yl)butan-2-one.
| Compound Name | 4-(2,5-dimethoxy-2H-furan-5-yl)butan-2-one |
|---|---|
| PubChem CID | 12937296 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-(2,5-dimethoxy-2H-furan-5-yl)butan-2-one |
| SMILES | COC1C=CC(CCC(C)=O)(OC)O1 |
| InChI | InChI=1S/C10H16O4/c1-8(11)4-6-10(13-3)7-5-9(12-2)14-10/h5,7,9H,4,6H2,1-3H3 |
| InChIKey | LLFFKCCPLFYUJH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|