C10H15FN2O — CID 129373572
[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[(1S,2S)-2-fluorocyclopropyl]methanone (PubChem CID 129373572) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is [(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[(1S,2S)-2-fluorocyclopropyl]methanone.
| Compound Name | [(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[(1S,2S)-2-fluorocyclopropyl]methanone |
|---|---|
| PubChem CID | 129373572 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | [(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[(1S,2S)-2-fluorocyclopropyl]methanone |
| SMILES | O=C([C@@H]1C[C@@H]1F)N1C[C@@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C10H15FN2O/c11-9-1-8(9)10(14)13-4-6-2-12-3-7(6)5-13/h6-9,12H,1-5H2/t6-,7-,8+,9-/m0/s1 |
| InChIKey | WJSJLTQPBJXQOW-MAUMQABQSA-N |
| XLogP | 0.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |