C22H26N2O2S — CID 129377382
(E)-N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]prop-2-enamide (PubChem CID 129377382) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is (E)-N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 129377382 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (E)-N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2nc(/C=C/C(=O)N[C@@H](C)[C@H]3C[C@H]4CC[C@H]3C4)cs2)cc1 |
| InChI | InChI=1S/C22H26N2O2S/c1-14(20-12-15-3-4-17(20)11-15)23-21(25)10-7-18-13-27-22(24-18)16-5-8-19(26-2)9-6-16/h5-10,13-15,17,20H,3-4,11-12H2,1-2H3,(H,23,25)/b10-7+/t14-,15-,17-,20+/m0/s1 |
| InChIKey | DRPTTYXRDVBETF-QCGJFUTMSA-N |
| XLogP | 4.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|