About 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one
5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one (PubChem CID 129378359) has the molecular formula C16H23ClN4O
and a molecular weight of 322.84 g/mol. Its IUPAC name is 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one.
Molecular Properties
| Compound Name | 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one |
| PubChem CID | 129378359 |
| Molecular Formula | C16H23ClN4O |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(N2CCN([C@H]3C[C@H]4CC[C@H]3C4)CC2)c(Cl)c1=O |
| InChI | InChI=1S/C16H23ClN4O/c1-19-16(22)15(17)14(10-18-19)21-6-4-20(5-7-21)13-9-11-2-3-12(13)8-11/h10-13H,2-9H2,1H3/t11-,12-,13-/m0/s1 |
| InChIKey | PMDZGBNVNQPHHV-AVGNSLFASA-N |
| XLogP | 1.74 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one?
The IUPAC name of 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one (CID 129378359) is 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one.
What is the SMILES notation for 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one?
The canonical SMILES for 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one is Cn1ncc(N2CCN([C@H]3C[C@H]4CC[C@H]3C4)CC2)c(Cl)c1=O.
What is the InChIKey of 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one?
The InChIKey is PMDZGBNVNQPHHV-AVGNSLFASA-N. The full InChI is InChI=1S/C16H23ClN4O/c1-19-16(22)15(17)14(10-18-19)21-6-4-20(5-7-21)13-9-11-2-3-12(13)8-11/h10-13H,2-9H2,1H3/t11-,12-,13-/m0/s1.
What are the key properties of 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one?
5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one has a molecular weight of 322.84 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-4-chloro-2-methylpyridazin-3-one is sourced from PubChem (CID 129378359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).