About trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid
trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 129379175) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 129379175 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | Cn1ccc(NC(=O)[C@H]2CCC[C@H](C(=O)O)C2)n1 |
| InChI | InChI=1S/C12H17N3O3/c1-15-6-5-10(14-15)13-11(16)8-3-2-4-9(7-8)12(17)18/h5-6,8-9H,2-4,7H2,1H3,(H,17,18)(H,13,14,16)/t8-,9-/m0/s1 |
| InChIKey | VAUWZUIHQXBVHZ-IUCAKERBSA-N |
| XLogP | 1.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid?
The IUPAC name of trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid (CID 129379175) is trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid is Cn1ccc(NC(=O)[C@H]2CCC[C@H](C(=O)O)C2)n1.
What is the InChIKey of trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid?
The InChIKey is VAUWZUIHQXBVHZ-IUCAKERBSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-15-6-5-10(14-15)13-11(16)8-3-2-4-9(7-8)12(17)18/h5-6,8-9H,2-4,7H2,1H3,(H,17,18)(H,13,14,16)/t8-,9-/m0/s1.
What are the key properties of trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid?
trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid has a molecular weight of 251.29 g/mol, XLogP of 1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,3S)-3-[(1-methylpyrazol-3-yl)carbamoyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 129379175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).