C22H16N2O4S — CID 1293809
N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]-2-phenylsulfanylacetamide (PubChem CID 1293809) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 1293809 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)Nc1ccc(Oc2ccc3c(c2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C22H16N2O4S/c25-20(13-29-17-4-2-1-3-5-17)23-14-6-8-15(9-7-14)28-16-10-11-18-19(12-16)22(27)24-21(18)26/h1-12H,13H2,(H,23,25)(H,24,26,27) |
| InChIKey | MFOVQHNVWYJKMO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|