C29H21BrN2O4S — CID 3651935
2-(4-bromophenyl)sulfanyl-N-[4-[2-(4-methylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]acetamide (PubChem CID 3651935) has the molecular formula C29H21BrN2O4S and a molecular weight of 573.47 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-[4-[2-(4-methylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]acetamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-[4-[2-(4-methylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 3651935 |
| Molecular Formula | C29H21BrN2O4S |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-[4-[2-(4-methylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]acetamide |
| SMILES | Cc1ccc(N2C(=O)c3ccc(Oc4ccc(NC(=O)CSc5ccc(Br)cc5)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C29H21BrN2O4S/c1-18-2-8-21(9-3-18)32-28(34)25-15-12-23(16-26(25)29(32)35)36-22-10-6-20(7-11-22)31-27(33)17-37-24-13-4-19(30)5-14-24/h2-16H,17H2,1H3,(H,31,33) |
| InChIKey | ZCKCYIXWSXIVOV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|