C12H17F3N4O2 — CID 129381577
cis-(1R,3S)-N-[2-(4-nitropyrazol-1-yl)ethyl]-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 129381577) has the molecular formula C12H17F3N4O2 and a molecular weight of 306.29 g/mol. Its IUPAC name is cis-(1R,3S)-N-[2-(4-nitropyrazol-1-yl)ethyl]-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | cis-(1R,3S)-N-[2-(4-nitropyrazol-1-yl)ethyl]-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 129381577 |
| Molecular Formula | C12H17F3N4O2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | cis-(1R,3S)-N-[2-(4-nitropyrazol-1-yl)ethyl]-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | O=[N+]([O-])c1cnn(CCN[C@@H]2CCC[C@H](C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C12H17F3N4O2/c13-12(14,15)9-2-1-3-10(6-9)16-4-5-18-8-11(7-17-18)19(20)21/h7-10,16H,1-6H2/t9-,10+/m0/s1 |
| InChIKey | KVAMYHJVFADLLK-VHSXEESVSA-N |
| XLogP | 2.50 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|