C16H12Cl2O3 — CID 129382473
(2S)-2-[(2,6-dichlorophenyl)methyl]-5-methoxy-1-benzofuran-3-one (PubChem CID 129382473) has the molecular formula C16H12Cl2O3 and a molecular weight of 323.18 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorophenyl)methyl]-5-methoxy-1-benzofuran-3-one.
| Compound Name | (2S)-2-[(2,6-dichlorophenyl)methyl]-5-methoxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 129382473 |
| Molecular Formula | C16H12Cl2O3 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (2S)-2-[(2,6-dichlorophenyl)methyl]-5-methoxy-1-benzofuran-3-one |
| SMILES | COc1ccc2c(c1)C(=O)[C@H](Cc1c(Cl)cccc1Cl)O2 |
| InChI | InChI=1S/C16H12Cl2O3/c1-20-9-5-6-14-11(7-9)16(19)15(21-14)8-10-12(17)3-2-4-13(10)18/h2-7,15H,8H2,1H3/t15-/m0/s1 |
| InChIKey | UEPXKQLIHQTKKJ-HNNXBMFYSA-N |
| XLogP | 4.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |