C8H11NO — CID 129383574
2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]acetonitrile (PubChem CID 129383574) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]acetonitrile.
| Compound Name | 2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]acetonitrile |
|---|---|
| PubChem CID | 129383574 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]acetonitrile |
| SMILES | N#CC[C@@]12CCCC[C@H]1O2 |
| InChI | InChI=1S/C8H11NO/c9-6-5-8-4-2-1-3-7(8)10-8/h7H,1-5H2/t7-,8+/m1/s1 |
| InChIKey | PXWXPPVZXWIBQW-SFYZADRCSA-N |
| XLogP | 1.61 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|