C14H13ClF2N2O2 — CID 129384140
(2R)-2-[1-(3-chloro-4-fluorobenzoyl)-4-fluoropiperidin-4-yl]-2-hydroxyacetonitrile (PubChem CID 129384140) has the molecular formula C14H13ClF2N2O2 and a molecular weight of 314.72 g/mol. Its IUPAC name is (2R)-2-[1-(3-chloro-4-fluorobenzoyl)-4-fluoropiperidin-4-yl]-2-hydroxyacetonitrile.
| Compound Name | (2R)-2-[1-(3-chloro-4-fluorobenzoyl)-4-fluoropiperidin-4-yl]-2-hydroxyacetonitrile |
|---|---|
| PubChem CID | 129384140 |
| Molecular Formula | C14H13ClF2N2O2 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (2R)-2-[1-(3-chloro-4-fluorobenzoyl)-4-fluoropiperidin-4-yl]-2-hydroxyacetonitrile |
| SMILES | N#C[C@@H](O)C1(F)CCN(C(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H13ClF2N2O2/c15-10-7-9(1-2-11(10)16)13(21)19-5-3-14(17,4-6-19)12(20)8-18/h1-2,7,12,20H,3-6H2/t12-/m1/s1 |
| InChIKey | XJNDSYKFCJSPON-GFCCVEGCSA-N |
| XLogP | 2.31 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|