C22H23ClF3NO2 — CID 158929508
(3-chloro-4-fluorophenyl)-[4-fluoro-4-[4-(4-fluorophenoxy)butyl]piperidin-1-yl]methanone (PubChem CID 158929508) has the molecular formula C22H23ClF3NO2 and a molecular weight of 425.88 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[4-fluoro-4-[4-(4-fluorophenoxy)butyl]piperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[4-fluoro-4-[4-(4-fluorophenoxy)butyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 158929508 |
| Molecular Formula | C22H23ClF3NO2 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[4-fluoro-4-[4-(4-fluorophenoxy)butyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1)N1CCC(F)(CCCCOc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H23ClF3NO2/c23-19-15-16(3-8-20(19)25)21(28)27-12-10-22(26,11-13-27)9-1-2-14-29-18-6-4-17(24)5-7-18/h3-8,15H,1-2,9-14H2 |
| InChIKey | KUOWQCKALCZFJB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|