C19H17Cl2F2NO4S — CID 2767869
[1-(3,4-dichlorobenzoyl)-4-fluoropiperidin-4-yl]methyl 4-fluorobenzenesulfonate (PubChem CID 2767869) has the molecular formula C19H17Cl2F2NO4S and a molecular weight of 464.32 g/mol. Its IUPAC name is [1-(3,4-dichlorobenzoyl)-4-fluoropiperidin-4-yl]methyl 4-fluorobenzenesulfonate.
| Compound Name | [1-(3,4-dichlorobenzoyl)-4-fluoropiperidin-4-yl]methyl 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 2767869 |
| Molecular Formula | C19H17Cl2F2NO4S |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | [1-(3,4-dichlorobenzoyl)-4-fluoropiperidin-4-yl]methyl 4-fluorobenzenesulfonate |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCC(F)(COS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H17Cl2F2NO4S/c20-16-6-1-13(11-17(16)21)18(25)24-9-7-19(23,8-10-24)12-28-29(26,27)15-4-2-14(22)3-5-15/h1-6,11H,7-10,12H2 |
| InChIKey | GHILIWJEKQWZIK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|