C20H22ClF2N3O2 — CID 158217367
(3-chloro-4-fluorophenyl)-[4-fluoro-4-(4-pyridazin-4-yloxybutyl)piperidin-1-yl]methanone (PubChem CID 158217367) has the molecular formula C20H22ClF2N3O2 and a molecular weight of 409.86 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[4-fluoro-4-(4-pyridazin-4-yloxybutyl)piperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[4-fluoro-4-(4-pyridazin-4-yloxybutyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 158217367 |
| Molecular Formula | C20H22ClF2N3O2 |
| Molecular Weight | 409.86 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[4-fluoro-4-(4-pyridazin-4-yloxybutyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1)N1CCC(F)(CCCCOc2ccnnc2)CC1 |
| InChI | InChI=1S/C20H22ClF2N3O2/c21-17-13-15(3-4-18(17)22)19(27)26-10-7-20(23,8-11-26)6-1-2-12-28-16-5-9-24-25-14-16/h3-5,9,13-14H,1-2,6-8,10-12H2 |
| InChIKey | LNCRJCJCHWTXAW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|