C21H23ClF2N2OS — CID 158217369
(3-chloro-4-fluorophenyl)-[4-fluoro-4-(4-pyridin-2-ylsulfanylbutyl)piperidin-1-yl]methanone (PubChem CID 158217369) has the molecular formula C21H23ClF2N2OS and a molecular weight of 424.94 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[4-fluoro-4-(4-pyridin-2-ylsulfanylbutyl)piperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[4-fluoro-4-(4-pyridin-2-ylsulfanylbutyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 158217369 |
| Molecular Formula | C21H23ClF2N2OS |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[4-fluoro-4-(4-pyridin-2-ylsulfanylbutyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1)N1CCC(F)(CCCCSc2ccccn2)CC1 |
| InChI | InChI=1S/C21H23ClF2N2OS/c22-17-15-16(6-7-18(17)23)20(27)26-12-9-21(24,10-13-26)8-2-4-14-28-19-5-1-3-11-25-19/h1,3,5-7,11,15H,2,4,8-10,12-14H2 |
| InChIKey | NHAHWRNJHNMBHO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|