C11H9ClO2 — CID 129384217
(1S)-4-oxo-2,3-dihydro-1H-naphthalene-1-carbonyl chloride (PubChem CID 129384217) has the molecular formula C11H9ClO2 and a molecular weight of 208.64 g/mol. Its IUPAC name is (1S)-4-oxo-2,3-dihydro-1H-naphthalene-1-carbonyl chloride.
| Compound Name | (1S)-4-oxo-2,3-dihydro-1H-naphthalene-1-carbonyl chloride |
|---|---|
| PubChem CID | 129384217 |
| Molecular Formula | C11H9ClO2 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | (1S)-4-oxo-2,3-dihydro-1H-naphthalene-1-carbonyl chloride |
| SMILES | O=C1CC[C@H](C(=O)Cl)c2ccccc21 |
| InChI | InChI=1S/C11H9ClO2/c12-11(14)9-5-6-10(13)8-4-2-1-3-7(8)9/h1-4,9H,5-6H2/t9-/m0/s1 |
| InChIKey | XTEFWFOUKZEXAU-VIFPVBQESA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|