C20H21NO2 — CID 129385045
(3R,4S)-4-(furan-3-yl)-3-(naphthalen-2-ylmethoxy)piperidine (PubChem CID 129385045) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3R,4S)-4-(furan-3-yl)-3-(naphthalen-2-ylmethoxy)piperidine.
| Compound Name | (3R,4S)-4-(furan-3-yl)-3-(naphthalen-2-ylmethoxy)piperidine |
|---|---|
| PubChem CID | 129385045 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3R,4S)-4-(furan-3-yl)-3-(naphthalen-2-ylmethoxy)piperidine |
| SMILES | c1ccc2cc(CO[C@H]3CNCC[C@H]3c3ccoc3)ccc2c1 |
| InChI | InChI=1S/C20H21NO2/c1-2-4-17-11-15(5-6-16(17)3-1)13-23-20-12-21-9-7-19(20)18-8-10-22-14-18/h1-6,8,10-11,14,19-21H,7,9,12-13H2/t19-,20-/m0/s1 |
| InChIKey | CYWLFZAPKAXVAI-PMACEKPBSA-N |
| XLogP | 4.10 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |