C13H20N2 — CID 129386795
(3S,4R)-4-benzyl-N,N-dimethylpyrrolidin-3-amine (PubChem CID 129386795) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (3S,4R)-4-benzyl-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-4-benzyl-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 129386795 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (3S,4R)-4-benzyl-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)[C@@H]1CNC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C13H20N2/c1-15(2)13-10-14-9-12(13)8-11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | GWHHWCKWPIVWJM-CHWSQXEVSA-N |
| XLogP | 1.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |