C24H24N2O — CID 70849292
(3R,4R)-4-benzyl-N,N-diphenylpyrrolidine-3-carboxamide (PubChem CID 70849292) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is (3R,4R)-4-benzyl-N,N-diphenylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-4-benzyl-N,N-diphenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 70849292 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (3R,4R)-4-benzyl-N,N-diphenylpyrrolidine-3-carboxamide |
| SMILES | O=C([C@H]1CNC[C@@H]1Cc1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O/c27-24(23-18-25-17-20(23)16-19-10-4-1-5-11-19)26(21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,20,23,25H,16-18H2/t20-,23-/m0/s1 |
| InChIKey | QOGZHAAJDOVYJA-REWPJTCUSA-N |
| XLogP | 4.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |