C10H16N2O3 — CID 129386918
ethyl (2S)-2-(1,5-dimethylpyrazol-4-yl)-2-hydroxypropanoate (PubChem CID 129386918) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is ethyl (2S)-2-(1,5-dimethylpyrazol-4-yl)-2-hydroxypropanoate.
| Compound Name | ethyl (2S)-2-(1,5-dimethylpyrazol-4-yl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 129386918 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethyl (2S)-2-(1,5-dimethylpyrazol-4-yl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@@](C)(O)c1cnn(C)c1C |
| InChI | InChI=1S/C10H16N2O3/c1-5-15-9(13)10(3,14)8-6-11-12(4)7(8)2/h6,14H,5H2,1-4H3/t10-/m0/s1 |
| InChIKey | XUNWCFXTMWNXID-JTQLQIEISA-N |
| XLogP | 0.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |