C10H22N+ — CID 129388701
(2S,6S)-1-ethyl-1,2,6-trimethylpiperidin-1-ium (PubChem CID 129388701) has the molecular formula C10H22N+ and a molecular weight of 156.29 g/mol. Its IUPAC name is (2S,6S)-1-ethyl-1,2,6-trimethylpiperidin-1-ium.
| Compound Name | (2S,6S)-1-ethyl-1,2,6-trimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 129388701 |
| Molecular Formula | C10H22N+ |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.17 |
| IUPAC Name | (2S,6S)-1-ethyl-1,2,6-trimethylpiperidin-1-ium |
| SMILES | CC[N+]1(C)[C@@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C10H22N/c1-5-11(4)9(2)7-6-8-10(11)3/h9-10H,5-8H2,1-4H3/q+1/t9-,10-/m0/s1 |
| InChIKey | QOURMEHOWGLDIZ-UWVGGRQHSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|