C22H46I2N2 — CID 155804918
1,2,6-trimethyl-1-[6-(1,2,6-trimethylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium diiodide (PubChem CID 155804918) has the molecular formula C22H46I2N2 and a molecular weight of 592.43 g/mol. Its IUPAC name is 1,2,6-trimethyl-1-[6-(1,2,6-trimethylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium diiodide.
| Compound Name | 1,2,6-trimethyl-1-[6-(1,2,6-trimethylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium diiodide |
|---|---|
| PubChem CID | 155804918 |
| Molecular Formula | C22H46I2N2 |
| Molecular Weight | 592.43 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 1,2,6-trimethyl-1-[6-(1,2,6-trimethylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium diiodide |
| SMILES | CC1CCCC(C)[N+]1(C)CCCCCC[N+]1(C)C(C)CCCC1C.[I-].[I-] |
| InChI | InChI=1S/C22H46N2.2HI/c1-19-13-11-14-20(2)23(19,5)17-9-7-8-10-18-24(6)21(3)15-12-16-22(24)4;;/h19-22H,7-18H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | MMMIWCBZIOUOMW-UHFFFAOYSA-L |
| XLogP | -0.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.43 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|