C25H44N2O2+2 — CID 100917118
(1S,5R)-8-methyl-8-[9-[(1R,5S)-8-methyl-3-oxo-8-azoniabicyclo[3.2.1]octan-8-yl]nonyl]-8-azoniabicyclo[3.2.1]octan-3-one (PubChem CID 100917118) has the molecular formula C25H44N2O2+2 and a molecular weight of 404.64 g/mol. Its IUPAC name is (1S,5R)-8-methyl-8-[9-[(1R,5S)-8-methyl-3-oxo-8-azoniabicyclo[3.2.1]octan-8-yl]nonyl]-8-azoniabicyclo[3.2.1]octan-3-one.
| Compound Name | (1S,5R)-8-methyl-8-[9-[(1R,5S)-8-methyl-3-oxo-8-azoniabicyclo[3.2.1]octan-8-yl]nonyl]-8-azoniabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 100917118 |
| Molecular Formula | C25H44N2O2+2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | (1S,5R)-8-methyl-8-[9-[(1R,5S)-8-methyl-3-oxo-8-azoniabicyclo[3.2.1]octan-8-yl]nonyl]-8-azoniabicyclo[3.2.1]octan-3-one |
| SMILES | C[N+]1(CCCCCCCCC[N+]2(C)[C@@H]3CC[C@H]2CC(=O)C3)[C@@H]2CC[C@H]1CC(=O)C2 |
| InChI | InChI=1S/C25H44N2O2/c1-26(20-10-11-21(26)17-24(28)16-20)14-8-6-4-3-5-7-9-15-27(2)22-12-13-23(27)19-25(29)18-22/h20-23H,3-19H2,1-2H3/q+2/t20-,21+,22-,23+,26?,27? |
| InChIKey | MZTARVOGBTZWBQ-HVJZPZHLSA-N |
| XLogP | 4.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|