C10H18NO+ — CID 53429583
3,3-dimethyl-3-azoniabicyclo[3.3.1]nonan-7-one (PubChem CID 53429583) has the molecular formula C10H18NO+ and a molecular weight of 168.26 g/mol. Its IUPAC name is 3,3-dimethyl-3-azoniabicyclo[3.3.1]nonan-7-one.
| Compound Name | 3,3-dimethyl-3-azoniabicyclo[3.3.1]nonan-7-one |
|---|---|
| PubChem CID | 53429583 |
| Molecular Formula | C10H18NO+ |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 3,3-dimethyl-3-azoniabicyclo[3.3.1]nonan-7-one |
| SMILES | C[N+]1(C)CC2CC(=O)CC(C2)C1 |
| InChI | InChI=1S/C10H18NO/c1-11(2)6-8-3-9(7-11)5-10(12)4-8/h8-9H,3-7H2,1-2H3/q+1 |
| InChIKey | SMPREGRCQGRGDD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|