C6H10O3 — CID 124561770
cis-(3S,5R)-3,5-dihydroxycyclohexan-1-one (PubChem CID 124561770) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is cis-(3S,5R)-3,5-dihydroxycyclohexan-1-one.
| Compound Name | cis-(3S,5R)-3,5-dihydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 124561770 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | cis-(3S,5R)-3,5-dihydroxycyclohexan-1-one |
| SMILES | O=C1C[C@@H](O)C[C@@H](O)C1 |
| InChI | InChI=1S/C6H10O3/c7-4-1-5(8)3-6(9)2-4/h4-5,7-8H,1-3H2/t4-,5+ |
| InChIKey | WTRJYFFVLSDQFC-SYDPRGILSA-N |
| XLogP | -0.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |