C7H12O3 — CID 130036383
2,5-dihydroxy-3-methylcyclohexan-1-one (PubChem CID 130036383) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is 2,5-dihydroxy-3-methylcyclohexan-1-one.
| Compound Name | 2,5-dihydroxy-3-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 130036383 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 2,5-dihydroxy-3-methylcyclohexan-1-one |
| SMILES | CC1CC(O)CC(=O)C1O |
| InChI | InChI=1S/C7H12O3/c1-4-2-5(8)3-6(9)7(4)10/h4-5,7-8,10H,2-3H2,1H3 |
| InChIKey | IMCMYARSBWMZLG-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |