C8H14O2 — CID 91573785
2-hydroxy-4,5-dimethylcyclohexan-1-one (PubChem CID 91573785) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-hydroxy-4,5-dimethylcyclohexan-1-one.
| Compound Name | 2-hydroxy-4,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 91573785 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-hydroxy-4,5-dimethylcyclohexan-1-one |
| SMILES | CC1CC(=O)C(O)CC1C |
| InChI | InChI=1S/C8H14O2/c1-5-3-7(9)8(10)4-6(5)2/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | PRZOHJDVWVDZIF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |