About cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one
cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one (PubChem CID 11389450) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one.
Analyze cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one?
The IUPAC name of cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one (CID 11389450) is cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one.
What is the SMILES notation for cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one?
The canonical SMILES for cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one is O=C1C[C@@H](CO)[C@@H](CO)C1.
What is the InChIKey of cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one?
The InChIKey is DALJGACNFLAEEC-OLQVQODUSA-N. The full InChI is InChI=1S/C7H12O3/c8-3-5-1-7(10)2-6(5)4-9/h5-6,8-9H,1-4H2/t5-,6+.
What are the key properties of cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one?
cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one has a molecular weight of 144.17 g/mol, XLogP of -0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3S,4R)-3,4-bis(hydroxymethyl)cyclopentan-1-one is sourced from PubChem (CID 11389450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).