C8H14O3 — CID 13239186
cis-(3R,5S)-3,5-bis(hydroxymethyl)cyclohexan-1-one (PubChem CID 13239186) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is cis-(3R,5S)-3,5-bis(hydroxymethyl)cyclohexan-1-one.
| Compound Name | cis-(3R,5S)-3,5-bis(hydroxymethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 13239186 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | cis-(3R,5S)-3,5-bis(hydroxymethyl)cyclohexan-1-one |
| SMILES | O=C1C[C@@H](CO)C[C@@H](CO)C1 |
| InChI | InChI=1S/C8H14O3/c9-4-6-1-7(5-10)3-8(11)2-6/h6-7,9-10H,1-5H2/t6-,7+ |
| InChIKey | ULBOQELOXZSALR-KNVOCYPGSA-N |
| XLogP | -0.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |