C10H18INO — CID 56972855
(1S,5R)-3,3-dimethyl-3-azoniabicyclo[3.3.1]nonan-7-one iodide (PubChem CID 56972855) has the molecular formula C10H18INO and a molecular weight of 295.16 g/mol. Its IUPAC name is (1S,5R)-3,3-dimethyl-3-azoniabicyclo[3.3.1]nonan-7-one iodide.
| Compound Name | (1S,5R)-3,3-dimethyl-3-azoniabicyclo[3.3.1]nonan-7-one iodide |
|---|---|
| PubChem CID | 56972855 |
| Molecular Formula | C10H18INO |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | (1S,5R)-3,3-dimethyl-3-azoniabicyclo[3.3.1]nonan-7-one iodide |
| SMILES | C[N+]1(C)C[C@@H]2CC(=O)C[C@@H](C2)C1.[I-] |
| InChI | InChI=1S/C10H18NO.HI/c1-11(2)6-8-3-9(7-11)5-10(12)4-8;/h8-9H,3-7H2,1-2H3;1H/q+1;/p-1/t8-,9+; |
| InChIKey | BLBRODNAIUSWGZ-UFIFRZAQSA-M |
| XLogP | -1.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|