C10H20NO+ — CID 98575483
(1S,5S)-8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol (PubChem CID 98575483) has the molecular formula C10H20NO+ and a molecular weight of 170.28 g/mol. Its IUPAC name is (1S,5S)-8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,5S)-8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 98575483 |
| Molecular Formula | C10H20NO+ |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | (1S,5S)-8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol |
| SMILES | CC[N+]1(C)[C@H]2CC[C@H]1CC(O)C2 |
| InChI | InChI=1S/C10H20NO/c1-3-11(2)8-4-5-9(11)7-10(12)6-8/h8-10,12H,3-7H2,1-2H3/q+1/t8-,9-,10?,11?/m0/s1 |
| InChIKey | XKYGQOAXSNEKOD-SAAXCQNUSA-N |
| XLogP | 1.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|