C11H20NO3+ — CID 98575485
methyl 2-[(1S,5S)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]acetate (PubChem CID 98575485) has the molecular formula C11H20NO3+ and a molecular weight of 214.28 g/mol. Its IUPAC name is methyl 2-[(1S,5S)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]acetate.
| Compound Name | methyl 2-[(1S,5S)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]acetate |
|---|---|
| PubChem CID | 98575485 |
| Molecular Formula | C11H20NO3+ |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | methyl 2-[(1S,5S)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]acetate |
| SMILES | COC(=O)C[N+]1(C)[C@H]2CC[C@H]1CC(O)C2 |
| InChI | InChI=1S/C11H20NO3/c1-12(7-11(14)15-2)8-3-4-9(12)6-10(13)5-8/h8-10,13H,3-7H2,1-2H3/q+1/t8-,9-,10?,12?/m0/s1 |
| InChIKey | KRDYSBSURXYWKN-RKVXJDFWSA-N |
| XLogP | 0.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|