C16H23NO2 — CID 129391252
ethyl 4-[(R)-amino-(3,3-dimethylcyclobutyl)methyl]benzoate (PubChem CID 129391252) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is ethyl 4-[(R)-amino-(3,3-dimethylcyclobutyl)methyl]benzoate.
| Compound Name | ethyl 4-[(R)-amino-(3,3-dimethylcyclobutyl)methyl]benzoate |
|---|---|
| PubChem CID | 129391252 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | ethyl 4-[(R)-amino-(3,3-dimethylcyclobutyl)methyl]benzoate |
| SMILES | CCOC(=O)c1ccc([C@H](N)C2CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H23NO2/c1-4-19-15(18)12-7-5-11(6-8-12)14(17)13-9-16(2,3)10-13/h5-8,13-14H,4,9-10,17H2,1-3H3/t14-/m0/s1 |
| InChIKey | YMLXNTWMJDCDKI-AWEZNQCLSA-N |
| XLogP | 3.30 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |