C14H17Cl2N3O — CID 129392908
2,3-dichloro-6-[(1S)-1-(2-imidazol-1-ylethylamino)propyl]phenol (PubChem CID 129392908) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is 2,3-dichloro-6-[(1S)-1-(2-imidazol-1-ylethylamino)propyl]phenol.
| Compound Name | 2,3-dichloro-6-[(1S)-1-(2-imidazol-1-ylethylamino)propyl]phenol |
|---|---|
| PubChem CID | 129392908 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2,3-dichloro-6-[(1S)-1-(2-imidazol-1-ylethylamino)propyl]phenol |
| SMILES | CC[C@H](NCCn1ccnc1)c1ccc(Cl)c(Cl)c1O |
| InChI | InChI=1S/C14H17Cl2N3O/c1-2-12(18-6-8-19-7-5-17-9-19)10-3-4-11(15)13(16)14(10)20/h3-5,7,9,12,18,20H,2,6,8H2,1H3/t12-/m0/s1 |
| InChIKey | AGUHHQMYSUJGMU-LBPRGKRZSA-N |
| XLogP | 3.64 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|